CAS 68499-97-8 appears in our catalog under these names: 8-Chloro-3-methyl-1H-pyrrolo(3,2-c)quinoline, 95%, 8-Chloro-3-methyl-1H-pyrrolo(3,2-c)quinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
8-chloro-3-methyl-1H-pyrrolo[3,2-c]quinoline (CAS 68499-97-8) is a chemical compound with the molecular formula C12H9ClN2 and a molecular weight of 216.66 g/mol. IUPAC name: 8-chloro-3-methyl-1H-pyrrolo[3,2-c]quinoline. InChIKey: LSQSVAQANKLBLE-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 8-chloro-3-methyl-1H-pyrrolo[3,2-c]quinoline |
| InChIKey | LSQSVAQANKLBLE-UHFFFAOYSA-N |
| SMILES | CC1=CNC2=C3C=C(C=CC3=NC=C12)Cl |
Computed by PubChem (NCBI)