Products 68548-74-3
CAS 68548-74-3 appears in our catalog under these names: 2-(4-Phenoxyphenyl)pyrrolidine hydrochloride, 95%, 95%, 2-(4-Phenoxyphenyl)pyrrolidine hydrochloride, 95% HPLC. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-(4-phenoxyphenyl)pyrrolidine;hydrochloride (CAS 68548-74-3) is a chemical compound with the molecular formula C16H18ClNO and a molecular weight of 275.77 g/mol. IUPAC name: 2-(4-phenoxyphenyl)pyrrolidine;hydrochloride. InChIKey: OWFDCXUURQWARA-UHFFFAOYSA-N.
| Molecular formula | C16H18ClNO |
|---|---|
| Molecular weight | 275.77 g/mol |
| IUPAC name | 2-(4-phenoxyphenyl)pyrrolidine;hydrochloride |
| InChIKey | OWFDCXUURQWARA-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC=C(C=C2)OC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)