CAS 6857-35-8 appears in our catalog under these names: 1-(4-Nitrophenyl)-1H-imidazole-2(5H)-thione, 95+%, 1-(4-Nitrophenyl)imidazoline-2-thione. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
4-(4-nitrophenyl)-1,3-dihydroimidazole-2-thione (CAS 6857-35-8) is a chemical compound with the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. IUPAC name: 4-(4-nitrophenyl)-1,3-dihydroimidazole-2-thione. InChIKey: VTJUTVFOBSHNSS-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2S |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | 4-(4-nitrophenyl)-1,3-dihydroimidazole-2-thione |
| InChIKey | VTJUTVFOBSHNSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CNC(=S)N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)