CAS 6859-11-6 appears in our catalog under these names: Hydantoin Impurity 1, Hydantoin Impurity 2, Hydantoin Impurity 20, 1-Methyl-5,5-diphenylimidazolidine-2,4-dione. Offered by: Chemat Brand, Hubei YoungXin, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 4x25mg.
1-methyl-5,5-diphenylimidazolidine-2,4-dione (CAS 6859-11-6) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: 1-methyl-5,5-diphenylimidazolidine-2,4-dione. InChIKey: XJFHNALJPCMIFS-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 1-methyl-5,5-diphenylimidazolidine-2,4-dione |
| InChIKey | XJFHNALJPCMIFS-UHFFFAOYSA-N |
| SMILES | CN1C(=O)NC(=O)C1(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)