Products 686736-69-6
CAS 686736-69-6 is the registry number for C175-0062. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 3-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-1H-indole-2-carboxylate (CAS 686736-69-6) is a chemical compound with the molecular formula C21H18N2O5 and a molecular weight of 378.4 g/mol. IUPAC name: ethyl 3-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-1H-indole-2-carboxylate. InChIKey: GGHPUMXBDYTGJS-CSKARUKUSA-N.
| Molecular formula | C21H18N2O5 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | ethyl 3-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-1H-indole-2-carboxylate |
| InChIKey | GGHPUMXBDYTGJS-CSKARUKUSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2N1)NC(=O)/C=C/C3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)