CAS 68674-48-6 is the registry number for 3,6-Dimethyl-2-phenyl-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.
3,6-dimethyl-2-phenyl-1H-indole (CAS 68674-48-6) is a chemical compound with the molecular formula C16H15N and a molecular weight of 221.30 g/mol. IUPAC name: 3,6-dimethyl-2-phenyl-1H-indole. InChIKey: RJGLHORSTFYBSQ-UHFFFAOYSA-N.
| Molecular formula | C16H15N |
|---|---|
| Molecular weight | 221.30 g/mol |
| IUPAC name | 3,6-dimethyl-2-phenyl-1H-indole |
| InChIKey | RJGLHORSTFYBSQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=C(N2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)