Products 68740-31-8
CAS 68740-31-8 is the registry number for 3-Nitro-4-(propylamino)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-nitro-4-(propylamino)benzoic acid (CAS 68740-31-8) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: 3-nitro-4-(propylamino)benzoic acid. InChIKey: OVDGUTHABMXVMI-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 3-nitro-4-(propylamino)benzoic acid |
| InChIKey | OVDGUTHABMXVMI-UHFFFAOYSA-N |
| SMILES | CCCNC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
3-nitro-4-(propylamino)benzoic acid, 3-nitro-4-propylamino-benzoic Acid, 4-(n-propyl)amino-3-nitrobenzoic acid, compound 5c [PMID: 17931863], Oprea1_580126, 3-nitro-4-propylaminobenzoic acid, OVDGUTHABMXVMI-UHFFFAOYSA-N, 3-nitro-4-(propylamino)benzoicacid, 3-nitro-4-n-propylaminobenzoic acid, 3-nitro-4-(propylamino)-benzoic acid