Products 68755-31-7
CAS 68755-31-7 appears in our catalog under these names: 5,6-Dichloro-indanone, 98%, 5,6-Dichloro-2,3-dihydro-1H-inden-1-one, 98%, 5,6-Dichloro-2,3-dihydro-1H-inden-1-one, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
5,6-dichloro-2,3-dihydroinden-1-one (CAS 68755-31-7) is a chemical compound with the molecular formula C9H6Cl2O and a molecular weight of 201.05 g/mol. IUPAC name: 5,6-dichloro-2,3-dihydroinden-1-one. InChIKey: KSTYRFWOQUWBCW-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 5,6-dichloro-2,3-dihydroinden-1-one |
| InChIKey | KSTYRFWOQUWBCW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)