CAS 68807-83-0 appears in our catalog under these names: Labetalol EP Impurity D, 5-(2-Amino-1-hydroxyethyl)-2-hydroxybenzamide, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 10mg, 25mg.
5-(2-amino-1-hydroxyethyl)-2-hydroxybenzamide (CAS 68807-83-0) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 5-(2-amino-1-hydroxyethyl)-2-hydroxybenzamide. InChIKey: WOEISFSYHVAQTR-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 5-(2-amino-1-hydroxyethyl)-2-hydroxybenzamide |
| InChIKey | WOEISFSYHVAQTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CN)O)C(=O)N)O |
Computed by PubChem (NCBI)