Products 688763-22-6
CAS 688763-22-6 is the registry number for 2-Bromo-4-trifluoromethylphenylisothiocyanate, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 25g.
2-bromo-1-isothiocyanato-4-(trifluoromethyl)benzene (CAS 688763-22-6) is a chemical compound with the molecular formula C8H3BrF3NS and a molecular weight of 282.08 g/mol. IUPAC name: 2-bromo-1-isothiocyanato-4-(trifluoromethyl)benzene. InChIKey: UMSVAXACZNPHEM-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NS |
|---|---|
| Molecular weight | 282.08 g/mol |
| IUPAC name | 2-bromo-1-isothiocyanato-4-(trifluoromethyl)benzene |
| InChIKey | UMSVAXACZNPHEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)N=C=S |
Computed by PubChem (NCBI)