CAS 69003-28-7 appears in our catalog under these names: Prilocaine Impurity 15, 2,2-Dichloro-N-(o-tolyl)propanamide, 95%, Prilocaine Impurity 11. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,2-dichloro-N-(2-methylphenyl)propanamide (CAS 69003-28-7) is a chemical compound with the molecular formula C10H11Cl2NO and a molecular weight of 232.10 g/mol. IUPAC name: 2,2-dichloro-N-(2-methylphenyl)propanamide. InChIKey: RMWGDFWPLUGTIQ-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 2,2-dichloro-N-(2-methylphenyl)propanamide |
| InChIKey | RMWGDFWPLUGTIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)C(C)(Cl)Cl |
Computed by PubChem (NCBI)