CAS 690260-95-8 is the registry number for Ethyl 3-amino-5-bromobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Ethyl 3-amino-5-bromobenzoate (CAS 690260-95-8) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: ethyl 3-amino-5-bromobenzoate. InChIKey: AGSSVQHQCFMXHB-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | ethyl 3-amino-5-bromobenzoate |
| InChIKey | AGSSVQHQCFMXHB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)Br)N |
Computed by PubChem (NCBI)