CAS 690636-03-4 appears in our catalog under these names: 2–Phenylthieno(3,2–c)pyridin–4(5H)–one, 2-Phenylthieno(3,2-c)pyridin-4(5H)-one, >95% (HPLC). Offered by: GLPBio, TRC. Available pack sizes: 100mg, 25mg, 50mg, 5mg.
2-phenyl-5H-thieno[3,2-c]pyridin-4-one (CAS 690636-03-4) is a chemical compound with the molecular formula C13H9NOS and a molecular weight of 227.28 g/mol. IUPAC name: 2-phenyl-5H-thieno[3,2-c]pyridin-4-one. InChIKey: RRCLOCLKUBNZEO-UHFFFAOYSA-N.
| Molecular formula | C13H9NOS |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 2-phenyl-5H-thieno[3,2-c]pyridin-4-one |
| InChIKey | RRCLOCLKUBNZEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(S2)C=CNC3=O |
Computed by PubChem (NCBI)