CAS 691007-05-3 appears in our catalog under these names: Iloperidone Impurity 31, (Z)-4-(2,4-Difluorobenzoyl)piperidine Oxime, >95% (HPLC), (Z)-(2,4-Difluorophenyl)-(4-piperidyl)methanone Oxime. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 250mg, 25mg.
(NZ)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine (CAS 691007-05-3) is a chemical compound with the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. IUPAC name: (NZ)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine. InChIKey: DAQWROFRHWHKFE-VBKFSLOCSA-N.
| Molecular formula | C12H14F2N2O |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | (NZ)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine |
| InChIKey | DAQWROFRHWHKFE-VBKFSLOCSA-N |
| SMILES | C1CNCCC1/C(=N/O)/C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)