CAS 691007-07-5 appears in our catalog under these names: Iloperidone Impurity 9, (E)-4-(2,4-Difluorobenzoyl)piperidine oxime, (E)-4-(2,4-Difluorobenzoyl)piperidine ox, ime, 1 mg, (E)-4-(2,4-Difluorobenzoyl)piperidine ox, ime, 2 mg, (E)-4-(2,4-Difluorobenzoyl)piperidine ox, ime, 5 mg. Offered by: Chemat Brand, Biosynth, Roth, Hubei YoungXin. Available pack sizes: on request, 2mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
(NE)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine (CAS 691007-07-5) is a chemical compound with the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. IUPAC name: (NE)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine. InChIKey: DAQWROFRHWHKFE-FOWTUZBSSA-N.
| Molecular formula | C12H14F2N2O |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | (NE)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine |
| InChIKey | DAQWROFRHWHKFE-FOWTUZBSSA-N |
| SMILES | C1CNCCC1/C(=N\O)/C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)