Products 691363-24-3

CAS 691363-24-3 is the registry number for 1-tert-Butyl-1,2,3-benzotriazole-5-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-tert-butylbenzotriazole-5-carboxylic acid (CAS 691363-24-3) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 1-tert-butylbenzotriazole-5-carboxylic acid. InChIKey: PIEIBXKCDFTGNA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13N3O2
Molecular weight219.24 g/mol
IUPAC name1-tert-butylbenzotriazole-5-carboxylic acid
InChIKeyPIEIBXKCDFTGNA-UHFFFAOYSA-N
SMILESCC(C)(C)N1C2=C(C=C(C=C2)C(=O)O)N=N1

Computed by PubChem (NCBI)