Products 69209-36-5

CAS 69209-36-5 is the registry number for 2,6-Diethylisonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,6-diethylpyridine-4-carboxylic acid (CAS 69209-36-5) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 2,6-diethylpyridine-4-carboxylic acid. InChIKey: MTWARANBIROLCZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO2
Molecular weight179.22 g/mol
IUPAC name2,6-diethylpyridine-4-carboxylic acid
InChIKeyMTWARANBIROLCZ-UHFFFAOYSA-N
SMILESCCC1=CC(=CC(=N1)CC)C(=O)O

Computed by PubChem (NCBI)