Products 692271-85-5
CAS 692271-85-5 is the registry number for 2-(2-Chloro-6-ethoxy-4-formylphenoxy)acetamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(2-chloro-6-ethoxy-4-formylphenoxy)acetamide (CAS 692271-85-5) is a chemical compound with the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. IUPAC name: 2-(2-chloro-6-ethoxy-4-formylphenoxy)acetamide. InChIKey: LIIYHMZQOKLGAI-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 2-(2-chloro-6-ethoxy-4-formylphenoxy)acetamide |
| InChIKey | LIIYHMZQOKLGAI-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C=O)Cl)OCC(=O)N |
Computed by PubChem (NCBI)