CAS 6941-17-9 appears in our catalog under these names: 2-Amino-1-(4-methylphenyl)-1-propanone Hydrochloride, >95% (HPLC), nor–Mephedrone (hydrochloride), 2-Amino-1-(4-methylphenyl)-1-propanone hydrochloride, 2-Amino-1-(4-methylphenyl)-1-propanone (hydrochloride). Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 10mg, 5mg, 50mg, 5000mg, 5 mg, 10 mg.
2-amino-1-(4-methylphenyl)propan-1-one;hydrochloride (CAS 6941-17-9) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 2-amino-1-(4-methylphenyl)propan-1-one;hydrochloride. InChIKey: FZNOSALCDVTESF-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 2-amino-1-(4-methylphenyl)propan-1-one;hydrochloride |
| InChIKey | FZNOSALCDVTESF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(C)N.Cl |
Computed by PubChem (NCBI)