Products 6943-33-5
CAS 6943-33-5 appears in our catalog under these names: 5-(3-Bromophenyl)-5-methylimidazolidine-2,4-dione, 98%, 5-(3-Bromo-phenyl)-5-methyl-imidazolidine-2,4-dione, 5-(3-Bromo-phenyl)-5-methyl-imidazolidine-2,4-dione, 98%, 5-(3-Bromo-phenyl)-5-methyl-imidazolidine-2,4-dione, 95%, 95%. Offered by: AmBeed, Biosynth, Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
5-(3-bromophenyl)-5-methylimidazolidine-2,4-dione (CAS 6943-33-5) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 5-(3-bromophenyl)-5-methylimidazolidine-2,4-dione. InChIKey: GWKFINAXYHAEHZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 5-(3-bromophenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | GWKFINAXYHAEHZ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)