CAS 6961-49-5 appears in our catalog under these names: N-(2-Chlorophenyl)glycine, 98%, 2-((2-Chlorophenyl)amino)acetic acid, 98%, N-(2-Chlorophenyl)glycine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 25g, 500mg, 250mg, 1000mg.
2-(2-chloroanilino)acetic acid (CAS 6961-49-5) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-(2-chloroanilino)acetic acid. InChIKey: NSDVLRONTCKCPY-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-(2-chloroanilino)acetic acid |
| InChIKey | NSDVLRONTCKCPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NCC(=O)O)Cl |
Computed by PubChem (NCBI)