CAS 69843-08-9 is the registry number for 1-Methoxy-4-[1-(trifluoromethyl)ethenyl]benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg.
1-methoxy-4-(3,3,3-trifluoroprop-1-en-2-yl)benzene (CAS 69843-08-9) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 1-methoxy-4-(3,3,3-trifluoroprop-1-en-2-yl)benzene. InChIKey: JPFVOTQCFBIJOQ-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 1-methoxy-4-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
| InChIKey | JPFVOTQCFBIJOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=C)C(F)(F)F |
Computed by PubChem (NCBI)