Products 69945-96-6
CAS 69945-96-6 is the registry number for 2-Chloro-6-(2-methylpropyl)pyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-chloro-6-(2-methylpropyl)pyridine-3-carbonitrile (CAS 69945-96-6) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 2-chloro-6-(2-methylpropyl)pyridine-3-carbonitrile. InChIKey: DLWNSWQKGJZWIP-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 2-chloro-6-(2-methylpropyl)pyridine-3-carbonitrile |
| InChIKey | DLWNSWQKGJZWIP-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=NC(=C(C=C1)C#N)Cl |
Computed by PubChem (NCBI)