Products 69975-68-4
CAS 69975-68-4 is the registry number for Ac-Ala-alpha-naphthyl ester. Offered by: Creative Peptides, Biosynth. Available pack sizes: 100mg, 500mg, 250mg, 1000mg.
Naphthalen-1-yl (2S)-2-acetamidopropanoate (CAS 69975-68-4) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: naphthalen-1-yl (2S)-2-acetamidopropanoate. InChIKey: QLHFGNPCPMZWQU-JTQLQIEISA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | naphthalen-1-yl (2S)-2-acetamidopropanoate |
| InChIKey | QLHFGNPCPMZWQU-JTQLQIEISA-N |
| SMILES | C[C@@H](C(=O)OC1=CC=CC2=CC=CC=C21)NC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Naaape, N-Acetylalanine alpha-naphthyl ester, L-Alanine, N-acetyl-, 1-naphthalenyl ester, naphthalen-1-yl (2S)-2-acetamidopropanoate, (S)-Naphthalen-1-yl 2-acetamidopropanoate, Ac-Ala-alpha-naphthyl ester, Acetyl-L-alanine-1-naphthyl ester, N-Acetyl-L-alanine alpha-naphthyl ester, Ac-Ala--naphthyl ester, alpha-naphthyl N-acetylalaninate