CAS 700-38-9 appears in our catalog under these names: 5-Methyl-2-nitrophenol, >95% (HPLC), 6–Nitro–m–cresol, 5-Methyl-2-nitrophenol, 97% , 5-Methyl-2-nitrophenol, 6-Nitro-m-cresol, >95.0%(T). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25g, 50g, 5g, 100g, 500g, 250g, 10g, 1kg.
5-methyl-2-nitrophenol (CAS 700-38-9) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 5-methyl-2-nitrophenol. InChIKey: NQXUSSVLFOBRSE-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 5-methyl-2-nitrophenol |
| InChIKey | NQXUSSVLFOBRSE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)