Products 700856-14-0

CAS 700856-14-0 is the registry number for Methyl 2-(4-formyl-2-methoxyphenoxy)propanoate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Methyl 2-(4-formyl-2-methoxyphenoxy)propanoate (CAS 700856-14-0) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: methyl 2-(4-formyl-2-methoxyphenoxy)propanoate. InChIKey: VMRFCVWUKKGUSN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O5
Molecular weight238.24 g/mol
IUPAC namemethyl 2-(4-formyl-2-methoxyphenoxy)propanoate
InChIKeyVMRFCVWUKKGUSN-UHFFFAOYSA-N
SMILESCC(C(=O)OC)OC1=C(C=C(C=C1)C=O)OC

Computed by PubChem (NCBI)