CAS 70149-42-7 is the registry number for 3-Bromo-5-nitropyridin-4(1H)-one. Offered by: Biosynth. Available pack sizes: 2,5g, 0,25g.
3-bromo-5-nitro-1H-pyridin-4-one (CAS 70149-42-7) is a chemical compound with the molecular formula C5H3BrN2O3 and a molecular weight of 218.99 g/mol. IUPAC name: 3-bromo-5-nitro-1H-pyridin-4-one. InChIKey: IIIJPRRVYYWKQW-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O3 |
|---|---|
| Molecular weight | 218.99 g/mol |
| IUPAC name | 3-bromo-5-nitro-1H-pyridin-4-one |
| InChIKey | IIIJPRRVYYWKQW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)C(=CN1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)