Products 70158-22-4

CAS 70158-22-4 is the registry number for 4-Ethoxy-2-oxo-2H-pyran-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-ethoxy-6-oxopyran-2-carboxylic acid (CAS 70158-22-4) is a chemical compound with the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. IUPAC name: 4-ethoxy-6-oxopyran-2-carboxylic acid. InChIKey: OKPRELRXYIVRRP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O5
Molecular weight184.15 g/mol
IUPAC name4-ethoxy-6-oxopyran-2-carboxylic acid
InChIKeyOKPRELRXYIVRRP-UHFFFAOYSA-N
SMILESCCOC1=CC(=O)OC(=C1)C(=O)O

Computed by PubChem (NCBI)