Products 70160-51-9
CAS 70160-51-9 is the registry number for ethyl 6-hydroxy-2-oxo-2H-chromene-3-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Ethyl 6-hydroxy-2-oxochromene-3-carboxylate (CAS 70160-51-9) is a chemical compound with the molecular formula C12H10O5 and a molecular weight of 234.20 g/mol. IUPAC name: ethyl 6-hydroxy-2-oxochromene-3-carboxylate. InChIKey: SSGYMCHQKAJEOB-UHFFFAOYSA-N.
| Molecular formula | C12H10O5 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | ethyl 6-hydroxy-2-oxochromene-3-carboxylate |
| InChIKey | SSGYMCHQKAJEOB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=CC(=C2)O)OC1=O |
Computed by PubChem (NCBI)