Products 70190-98-6
CAS 70190-98-6 is the registry number for N-Lactylvaline, 99.93%. Offered by: MedChemExpress. Available pack sizes: 5 mg.
(2S)-2-(2-hydroxypropanoylamino)-3-methylbutanoic acid (CAS 70190-98-6) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (2S)-2-(2-hydroxypropanoylamino)-3-methylbutanoic acid. InChIKey: IJKKTQLUXOILBQ-GDVGLLTNSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (2S)-2-(2-hydroxypropanoylamino)-3-methylbutanoic acid |
| InChIKey | IJKKTQLUXOILBQ-GDVGLLTNSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)C(C)O |
Computed by PubChem (NCBI)