Products 70258-77-4
CAS 70258-77-4 appears in our catalog under these names: Methyl 3–hydroxy–5–methoxy–1H–indole–2–carboxylate, Methyl 3-hydroxy-5-methoxy-1H-indole-2-carboxylate, 98%. Offered by: GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 3-hydroxy-5-methoxy-1H-indole-2-carboxylate (CAS 70258-77-4) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: methyl 3-hydroxy-5-methoxy-1H-indole-2-carboxylate. InChIKey: RMXXPYJJTXRFCX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | methyl 3-hydroxy-5-methoxy-1H-indole-2-carboxylate |
| InChIKey | RMXXPYJJTXRFCX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=C2O)C(=O)OC |
Computed by PubChem (NCBI)