CAS 70260-93-4 is the registry number for 6-((Oxiran-2-yl)methoxy)-1H-indole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(oxiran-2-ylmethoxy)-1H-indole (CAS 70260-93-4) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 6-(oxiran-2-ylmethoxy)-1H-indole. InChIKey: FNAUUGIPMZMODT-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 6-(oxiran-2-ylmethoxy)-1H-indole |
| InChIKey | FNAUUGIPMZMODT-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=CC3=C(C=C2)C=CN3 |
Computed by PubChem (NCBI)