CAS 70343-13-4 appears in our catalog under these names: 7-Methyl-5-nitro-1h-indole-2,3-dione, 95%, 7–Methyl–5–Nitroisatin, 7-Methyl-5-nitroindoline-2,3-dione 98%, 7-Methyl-5-nitro-1h-indole-2,3-dione, 97%, 97%, 7-Methyl-5-nitroindoline-2,3-dione, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
7-methyl-5-nitro-1H-indole-2,3-dione (CAS 70343-13-4) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: 7-methyl-5-nitro-1H-indole-2,3-dione. InChIKey: VREHMPHOKRQMFE-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 7-methyl-5-nitro-1H-indole-2,3-dione |
| InChIKey | VREHMPHOKRQMFE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=O)C2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)