Products 70420-58-5
CAS 70420-58-5 appears in our catalog under these names: Fissistigine A, FissistigineA, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 50mg, 25mg, 5mg, 10mg.
(12R)-16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaen-18-ol (CAS 70420-58-5) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: (12R)-16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaen-18-ol. InChIKey: PTEWWARRGIJHQK-GFCCVEGCSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (12R)-16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaen-18-ol |
| InChIKey | PTEWWARRGIJHQK-GFCCVEGCSA-N |
| SMILES | COC1=CC2=C(C(=C1)O)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5 |
Computed by PubChem (NCBI)