Products 705-79-3
CAS 705-79-3 appears in our catalog under these names: 3–Chloro–4–fluorophenylacetic acid, 3-Chloro-4-fluorophenylacetic acid 95%, 3-Chloro-4-fluorophenylacetic acid, 98%, 3-Chloro-4-fluorophenylacetic acid, >95% (HPLC), 3-Chloro-4-fluorophenylacetic acid, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, TRC, Chemat. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g, 100mg, 500mg.
2-(3-chloro-4-fluorophenyl)acetic acid (CAS 705-79-3) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-(3-chloro-4-fluorophenyl)acetic acid. InChIKey: WGODGMOMOMNTRN-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-(3-chloro-4-fluorophenyl)acetic acid |
| InChIKey | WGODGMOMOMNTRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)Cl)F |
Computed by PubChem (NCBI)