CAS 32890-89-4 appears in our catalog under these names: 2-Chloro-6-fluoro-3-methylbenzoic acid, 95%, 2-Chloro-6-fluoro-3-methylbenzoic acid, 98%, 2-Chloro-6-fluoro-3-methylbenzoic acid, 98%, 98%, 2-Chloro-6-fluoro-3-methylbenzoic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2-chloro-6-fluoro-3-methylbenzoic acid (CAS 32890-89-4) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-chloro-6-fluoro-3-methylbenzoic acid. InChIKey: VCNCNVOMGXWTBZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-chloro-6-fluoro-3-methylbenzoic acid |
| InChIKey | VCNCNVOMGXWTBZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C(=O)O)Cl |
Computed by PubChem (NCBI)