CAS 261762-96-3 appears in our catalog under these names: 3–Chloro–2–fluorophenylacetic acid, 3-Chloro-2-fluorophenylacetic acid, 3-Chloro-2-fluorophenylacetic acid, 98%, 3-Chloro-2-fluorophenylacetic acid, 95%, 2-(3-Chloro-2-fluorophenyl)acetic acid, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 100g, 10g, 25g, 5g, 1g, 500g, 250mg.
2-(3-chloro-2-fluorophenyl)acetic acid (CAS 261762-96-3) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-(3-chloro-2-fluorophenyl)acetic acid. InChIKey: LBGHWXGWKTZILK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-(3-chloro-2-fluorophenyl)acetic acid |
| InChIKey | LBGHWXGWKTZILK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)CC(=O)O |
Computed by PubChem (NCBI)