Products 261762-97-4
CAS 261762-97-4 appears in our catalog under these names: 2-(5-Chloro-2-fluorophenyl)acetic acid, 97%, 97%, 5-Chloro-2-fluorophenylacetic acid, 97%, 2-(5-Chloro-2-fluorophenyl)acetic acid 97%, 5-Chloro-2-fluorophenylacetic acid, 95%. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
2-(5-chloro-2-fluorophenyl)acetic acid (CAS 261762-97-4) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-(5-chloro-2-fluorophenyl)acetic acid. InChIKey: NOKLOLLCDCEFAK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-(5-chloro-2-fluorophenyl)acetic acid |
| InChIKey | NOKLOLLCDCEFAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(=O)O)F |
Computed by PubChem (NCBI)