CAS 70555-46-3 appears in our catalog under these names: 6-Methoxy-1H-indole-3-carbaldehyde 98%, 6-Methoxy-1H-indole-3-carbaldehyde, 95%, 6-Methoxy-1H-indole-3-carbaldehyde, 98+%, 98+%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
6-methoxy-1H-indole-3-carbaldehyde (CAS 70555-46-3) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 6-methoxy-1H-indole-3-carbaldehyde. InChIKey: JTEFJNIWWXTBMP-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 6-methoxy-1H-indole-3-carbaldehyde |
| InChIKey | JTEFJNIWWXTBMP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CN2)C=O |
Computed by PubChem (NCBI)