Products 7057-10-5
CAS 7057-10-5 is the registry number for (3aR,3bS,6aR,7aR)-2,2-Dimethyltetrahydrofuro(2',3':4,5)furo(2,3-d)(1,3)dioxol-5(3aH)-one. Offered by: Biosynth. Available pack sizes: 10g, 5g, 25g, 50g.
(1S,2R,6R,8R)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one (CAS 7057-10-5) is a chemical compound with the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. IUPAC name: (1S,2R,6R,8R)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one. InChIKey: YKKJYSDODXHPRR-PXBUCIJWSA-N.
| Molecular formula | C9H12O5 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | (1S,2R,6R,8R)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
| InChIKey | YKKJYSDODXHPRR-PXBUCIJWSA-N |
| SMILES | CC1(O[C@@H]2[C@@H]3[C@@H](CC(=O)O3)O[C@@H]2O1)C |
Computed by PubChem (NCBI)