Products 70692-44-3
CAS 70692-44-3 appears in our catalog under these names: 4-Chloro-2-methyl-1-(trifluoromethoxy)benzene, 95%, 4-Chloro-2-methyl-1-(trifluoromethoxy)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-chloro-2-methyl-1-(trifluoromethoxy)benzene (CAS 70692-44-3) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 4-chloro-2-methyl-1-(trifluoromethoxy)benzene. InChIKey: NDZHSPDLTLLMSL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 4-chloro-2-methyl-1-(trifluoromethoxy)benzene |
| InChIKey | NDZHSPDLTLLMSL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)