Products 70849-22-8
CAS 70849-22-8 is the registry number for D-Lyxose-13C-2. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(2S,3S,4R)-2,3,4,5-tetrahydroxy(113C)pentanal (CAS 70849-22-8) is a chemical compound with the molecular formula C5H10O5 and a molecular weight of 151.12 g/mol. IUPAC name: (2S,3S,4R)-2,3,4,5-tetrahydroxy(113C)pentanal. InChIKey: PYMYPHUHKUWMLA-IQGOOSNCSA-N.
| Molecular formula | C5H10O5 |
|---|---|
| Molecular weight | 151.12 g/mol |
| IUPAC name | (2S,3S,4R)-2,3,4,5-tetrahydroxy(113C)pentanal |
| InChIKey | PYMYPHUHKUWMLA-IQGOOSNCSA-N |
| SMILES | C([C@H]([C@@H]([C@@H]([13CH]=O)O)O)O)O |
Computed by PubChem (NCBI)