CAS 70897-15-3 appears in our catalog under these names: (S)–Benzyl (1–amino–3–hydroxy–1–oxopropan–2–yl)carbamate, Cbz-Ser-NH2 98%, Z-Ser-NH2, 98%, 98%, (S)-Benzyl (1-amino-3-hydroxy-1-oxopropan-2-yl)carbamate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 10g.
Benzyl N-[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate (CAS 70897-15-3) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: benzyl N-[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate. InChIKey: NGEWHDOZPGSSLG-VIFPVBQESA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | benzyl N-[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate |
| InChIKey | NGEWHDOZPGSSLG-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CO)C(=O)N |
Computed by PubChem (NCBI)