Products 71056-58-1
CAS 71056-58-1 is the registry number for Ethyl 5-amino-1-methyl-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg.
Ethyl 5-amino-1-methylindole-2-carboxylate (CAS 71056-58-1) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: ethyl 5-amino-1-methylindole-2-carboxylate. InChIKey: WPRKJQVJYKGTLF-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | ethyl 5-amino-1-methylindole-2-carboxylate |
| InChIKey | WPRKJQVJYKGTLF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1C)C=CC(=C2)N |
Computed by PubChem (NCBI)