CAS 71072-37-2 appears in our catalog under these names: 1-(2,2-Dimethylpropanoyl)piperidin-4-one, 95%, 1-(2,2-Dimethylpropanoyl)piperidin-4-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-(2,2-dimethylpropanoyl)piperidin-4-one (CAS 71072-37-2) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: 1-(2,2-dimethylpropanoyl)piperidin-4-one. InChIKey: GAKRFXBXTBSAOJ-UHFFFAOYSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 1-(2,2-dimethylpropanoyl)piperidin-4-one |
| InChIKey | GAKRFXBXTBSAOJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1CCC(=O)CC1 |
Computed by PubChem (NCBI)