Products 711-02-4
CAS 711-02-4 appears in our catalog under these names: Bicyclo[2.2.2]octane-1,4-dicarboxylic acid, 96%, Bicyclo[2.2.2]octane-1,4-dicarboxylic Acid, >98.0%(GC)(T), bicyclo[2.2.2]octane-1,4-dicarboxylic acid 96%, bicyclo[2.2.2]octane-1,4-dicarboxylicacid, 96%, 96%, Bicyclo[2.2.2]octane-1,4-dicarboxylic acid, 99.74%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 1000g, 10g, 1 g, 5 g, 25 g, 10 g.
Bicyclo[2.2.2]octane-1,4-dicarboxylic acid (CAS 711-02-4) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: bicyclo[2.2.2]octane-1,4-dicarboxylic acid. InChIKey: KVOACUMJSXEJQT-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | bicyclo[2.2.2]octane-1,4-dicarboxylic acid |
| InChIKey | KVOACUMJSXEJQT-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(CC2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)