Products 71172-79-7
CAS 71172-79-7 is the registry number for Cyclopropyl(2,4-dimethylphenyl)methanone, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Cyclopropyl-(2,4-dimethylphenyl)methanone (CAS 71172-79-7) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: cyclopropyl-(2,4-dimethylphenyl)methanone. InChIKey: CENWGMGAFRZWTJ-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | cyclopropyl-(2,4-dimethylphenyl)methanone |
| InChIKey | CENWGMGAFRZWTJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)C2CC2)C |
Computed by PubChem (NCBI)