CAS 71176-55-1 appears in our catalog under these names: (5–Nitro–1,3–phenylene)dimethanol, (5-Nitro-1,3-phenylene)dimethanol 95%, 5-NITRO-M-XYLENE-ALPHA,ALPHA'-DIOL, 96%, 5-Nitro-1,3-benzenedimethanol, 95%, 95%, (5-Nitro-1,3-phenylene)dimethanol, 98%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 25g.
[3-(hydroxymethyl)-5-nitrophenyl]methanol (CAS 71176-55-1) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: [3-(hydroxymethyl)-5-nitrophenyl]methanol. InChIKey: FTLFITNFXXERLN-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | [3-(hydroxymethyl)-5-nitrophenyl]methanol |
| InChIKey | FTLFITNFXXERLN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1CO)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)