CAS 712294-46-7 appears in our catalog under these names: 3-Bromo-4,5-diethoxybenzoic acid, 95%, 3-Bromo-4,5-diethoxybenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-bromo-4,5-diethoxybenzoic acid (CAS 712294-46-7) is a chemical compound with the molecular formula C11H13BrO4 and a molecular weight of 289.12 g/mol. IUPAC name: 3-bromo-4,5-diethoxybenzoic acid. InChIKey: VPNPMOZAIFPDHR-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO4 |
|---|---|
| Molecular weight | 289.12 g/mol |
| IUPAC name | 3-bromo-4,5-diethoxybenzoic acid |
| InChIKey | VPNPMOZAIFPDHR-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C(=O)O)Br)OCC |
Computed by PubChem (NCBI)