CAS 713-02-0 is the registry number for 4,4,4-Trifluoro-1-phenylbutan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg, 250mg, 500mg.
4,4,4-trifluoro-1-phenylbutan-1-one (CAS 713-02-0) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 4,4,4-trifluoro-1-phenylbutan-1-one. InChIKey: IRWRIGHYGSXWOL-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-phenylbutan-1-one |
| InChIKey | IRWRIGHYGSXWOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CCC(F)(F)F |
Computed by PubChem (NCBI)